C18H20Cl2N2O — CID 18088218
N-[2-(3-chlorophenyl)ethyl]-2-[1-(2-chlorophenyl)ethylamino]acetamide (PubChem CID 18088218) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-2-[1-(2-chlorophenyl)ethylamino]acetamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-2-[1-(2-chlorophenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 18088218 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-2-[1-(2-chlorophenyl)ethylamino]acetamide |
| SMILES | CC(NCC(=O)NCCc1cccc(Cl)c1)c1ccccc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O/c1-13(16-7-2-3-8-17(16)20)22-12-18(23)21-10-9-14-5-4-6-15(19)11-14/h2-8,11,13,22H,9-10,12H2,1H3,(H,21,23) |
| InChIKey | MQRZVMMGLGDWMK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |