C20H25ClN2O — CID 9306812
2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-[(2R)-4-phenylbutan-2-yl]acetamide (PubChem CID 9306812) has the molecular formula C20H25ClN2O and a molecular weight of 344.89 g/mol. Its IUPAC name is 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-[(2R)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-[(2R)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 9306812 |
| Molecular Formula | C20H25ClN2O |
| Molecular Weight | 344.89 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-N-[(2R)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)CN[C@H](C)c1ccccc1Cl |
| InChI | InChI=1S/C20H25ClN2O/c1-15(12-13-17-8-4-3-5-9-17)23-20(24)14-22-16(2)18-10-6-7-11-19(18)21/h3-11,15-16,22H,12-14H2,1-2H3,(H,23,24)/t15-,16-/m1/s1 |
| InChIKey | SNJBKNSMKYRFRW-HZPDHXFCSA-N |
| XLogP | 4.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.89 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |