C25H28N2O — CID 7516085
2-(benzhydrylamino)-N-[(2S)-4-phenylbutan-2-yl]acetamide (PubChem CID 7516085) has the molecular formula C25H28N2O and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-(benzhydrylamino)-N-[(2S)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(benzhydrylamino)-N-[(2S)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 7516085 |
| Molecular Formula | C25H28N2O |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-(benzhydrylamino)-N-[(2S)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)CNC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28N2O/c1-20(17-18-21-11-5-2-6-12-21)27-24(28)19-26-25(22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,20,25-26H,17-19H2,1H3,(H,27,28)/t20-/m0/s1 |
| InChIKey | XWVFTDOJZHDTPA-FQEVSTJZSA-N |
| XLogP | 4.50 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |