C17H21NO2 — CID 107711813
2-[1-(N,2,4-trimethylanilino)ethyl]benzene-1,3-diol (PubChem CID 107711813) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[1-(N,2,4-trimethylanilino)ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-(N,2,4-trimethylanilino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107711813 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-[1-(N,2,4-trimethylanilino)ethyl]benzene-1,3-diol |
| SMILES | Cc1ccc(N(C)C(C)c2c(O)cccc2O)c(C)c1 |
| InChI | InChI=1S/C17H21NO2/c1-11-8-9-14(12(2)10-11)18(4)13(3)17-15(19)6-5-7-16(17)20/h5-10,13,19-20H,1-4H3 |
| InChIKey | RUEIGMWDMRJLEY-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|