C16H19NO2 — CID 107711796
2-[1-(N,3-dimethylanilino)ethyl]benzene-1,3-diol (PubChem CID 107711796) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-[1-(N,3-dimethylanilino)ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-(N,3-dimethylanilino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107711796 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-[1-(N,3-dimethylanilino)ethyl]benzene-1,3-diol |
| SMILES | Cc1cccc(N(C)C(C)c2c(O)cccc2O)c1 |
| InChI | InChI=1S/C16H19NO2/c1-11-6-4-7-13(10-11)17(3)12(2)16-14(18)8-5-9-15(16)19/h4-10,12,18-19H,1-3H3 |
| InChIKey | JIEGXNZMXWGECQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|