C16H19NO2 — CID 107707977
5-[1-(N,3-dimethylanilino)ethyl]benzene-1,3-diol (PubChem CID 107707977) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 5-[1-(N,3-dimethylanilino)ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-(N,3-dimethylanilino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107707977 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 5-[1-(N,3-dimethylanilino)ethyl]benzene-1,3-diol |
| SMILES | Cc1cccc(N(C)C(C)c2cc(O)cc(O)c2)c1 |
| InChI | InChI=1S/C16H19NO2/c1-11-5-4-6-14(7-11)17(3)12(2)13-8-15(18)10-16(19)9-13/h4-10,12,18-19H,1-3H3 |
| InChIKey | XEQKZXZIYIANQW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |