C17H29NO2 — CID 107712006
2-[1-[2-methylpropyl(pentan-3-yl)amino]ethyl]benzene-1,3-diol (PubChem CID 107712006) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 2-[1-[2-methylpropyl(pentan-3-yl)amino]ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-[2-methylpropyl(pentan-3-yl)amino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107712006 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 2-[1-[2-methylpropyl(pentan-3-yl)amino]ethyl]benzene-1,3-diol |
| SMILES | CCC(CC)N(CC(C)C)C(C)c1c(O)cccc1O |
| InChI | InChI=1S/C17H29NO2/c1-6-14(7-2)18(11-12(3)4)13(5)17-15(19)9-8-10-16(17)20/h8-10,12-14,19-20H,6-7,11H2,1-5H3 |
| InChIKey | TWWINQBHMJPCAX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|