C13H15N3O2 — CID 107713663
2-[2-[(5,6-dimethyl-1,2,4-triazin-3-yl)oxy]phenyl]ethanol (PubChem CID 107713663) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-[2-[(5,6-dimethyl-1,2,4-triazin-3-yl)oxy]phenyl]ethanol.
| Compound Name | 2-[2-[(5,6-dimethyl-1,2,4-triazin-3-yl)oxy]phenyl]ethanol |
|---|---|
| PubChem CID | 107713663 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-[2-[(5,6-dimethyl-1,2,4-triazin-3-yl)oxy]phenyl]ethanol |
| SMILES | Cc1nnc(Oc2ccccc2CCO)nc1C |
| InChI | InChI=1S/C13H15N3O2/c1-9-10(2)15-16-13(14-9)18-12-6-4-3-5-11(12)7-8-17/h3-6,17H,7-8H2,1-2H3 |
| InChIKey | OHLDNLQEZGHCFL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |