C11H3ClF4N2O3 — CID 107716626
4-(2-chloro-6-nitrophenoxy)-2,3,5,6-tetrafluoropyridine (PubChem CID 107716626) has the molecular formula C11H3ClF4N2O3 and a molecular weight of 322.60 g/mol. Its IUPAC name is 4-(2-chloro-6-nitrophenoxy)-2,3,5,6-tetrafluoropyridine.
| Compound Name | 4-(2-chloro-6-nitrophenoxy)-2,3,5,6-tetrafluoropyridine |
|---|---|
| PubChem CID | 107716626 |
| Molecular Formula | C11H3ClF4N2O3 |
| Molecular Weight | 322.60 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 4-(2-chloro-6-nitrophenoxy)-2,3,5,6-tetrafluoropyridine |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1Oc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C11H3ClF4N2O3/c12-4-2-1-3-5(18(19)20)8(4)21-9-6(13)10(15)17-11(16)7(9)14/h1-3H |
| InChIKey | WEMFMLPTDFCCGX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|