C16H25FN2O2 — CID 107718581
2-[4-[(1R)-1-aminoethyl]-3-fluorophenoxy]-N-pentan-3-ylpropanamide (PubChem CID 107718581) has the molecular formula C16H25FN2O2 and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-[4-[(1R)-1-aminoethyl]-3-fluorophenoxy]-N-pentan-3-ylpropanamide.
| Compound Name | 2-[4-[(1R)-1-aminoethyl]-3-fluorophenoxy]-N-pentan-3-ylpropanamide |
|---|---|
| PubChem CID | 107718581 |
| Molecular Formula | C16H25FN2O2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 2-[4-[(1R)-1-aminoethyl]-3-fluorophenoxy]-N-pentan-3-ylpropanamide |
| SMILES | CCC(CC)NC(=O)C(C)Oc1ccc([C@@H](C)N)c(F)c1 |
| InChI | InChI=1S/C16H25FN2O2/c1-5-12(6-2)19-16(20)11(4)21-13-7-8-14(10(3)18)15(17)9-13/h7-12H,5-6,18H2,1-4H3,(H,19,20)/t10-,11?/m1/s1 |
| InChIKey | HLYQIFGSMYDGTF-NFJWQWPMSA-N |
| XLogP | 2.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |