C16H24FNO3 — CID 107720399
2-[3-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-N-pentan-2-ylpropanamide (PubChem CID 107720399) has the molecular formula C16H24FNO3 and a molecular weight of 297.37 g/mol. Its IUPAC name is 2-[3-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-N-pentan-2-ylpropanamide.
| Compound Name | 2-[3-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-N-pentan-2-ylpropanamide |
|---|---|
| PubChem CID | 107720399 |
| Molecular Formula | C16H24FNO3 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-[3-fluoro-4-[(1S)-1-hydroxyethyl]phenoxy]-N-pentan-2-ylpropanamide |
| SMILES | CCCC(C)NC(=O)C(C)Oc1ccc([C@H](C)O)c(F)c1 |
| InChI | InChI=1S/C16H24FNO3/c1-5-6-10(2)18-16(20)12(4)21-13-7-8-14(11(3)19)15(17)9-13/h7-12,19H,5-6H2,1-4H3,(H,18,20)/t10?,11-,12?/m0/s1 |
| InChIKey | XSRHEWFHFJJRNU-CXQJBGSLSA-N |
| XLogP | 2.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |