C15H16N2O4 — CID 107721250
N-[2-(2-aminoethoxy)phenyl]-2,5-dihydroxybenzamide (PubChem CID 107721250) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)phenyl]-2,5-dihydroxybenzamide.
| Compound Name | N-[2-(2-aminoethoxy)phenyl]-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107721250 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[2-(2-aminoethoxy)phenyl]-2,5-dihydroxybenzamide |
| SMILES | NCCOc1ccccc1NC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C15H16N2O4/c16-7-8-21-14-4-2-1-3-12(14)17-15(20)11-9-10(18)5-6-13(11)19/h1-6,9,18-19H,7-8,16H2,(H,17,20) |
| InChIKey | KIUCCQSUXIJUJP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|