C14H10N2O3 — CID 107721971
N-(2-cyanophenyl)-2,5-dihydroxybenzamide (PubChem CID 107721971) has the molecular formula C14H10N2O3 and a molecular weight of 254.25 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2,5-dihydroxybenzamide.
| Compound Name | N-(2-cyanophenyl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107721971 |
| Molecular Formula | C14H10N2O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-(2-cyanophenyl)-2,5-dihydroxybenzamide |
| SMILES | N#Cc1ccccc1NC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H10N2O3/c15-8-9-3-1-2-4-12(9)16-14(19)11-7-10(17)5-6-13(11)18/h1-7,17-18H,(H,16,19) |
| InChIKey | LPDDNYMOQNXZSP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|