C15H14N2O3 — CID 107721484
(5-amino-1,3-dihydroisoindol-2-yl)-(2,5-dihydroxyphenyl)methanone (PubChem CID 107721484) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is (5-amino-1,3-dihydroisoindol-2-yl)-(2,5-dihydroxyphenyl)methanone.
| Compound Name | (5-amino-1,3-dihydroisoindol-2-yl)-(2,5-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 107721484 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (5-amino-1,3-dihydroisoindol-2-yl)-(2,5-dihydroxyphenyl)methanone |
| SMILES | Nc1ccc2c(c1)CN(C(=O)c1cc(O)ccc1O)C2 |
| InChI | InChI=1S/C15H14N2O3/c16-11-2-1-9-7-17(8-10(9)5-11)15(20)13-6-12(18)3-4-14(13)19/h1-6,18-19H,7-8,16H2 |
| InChIKey | XGAWFGCSDYBCAW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|