C16H16N2O3 — CID 107721490
(7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(2,5-dihydroxyphenyl)methanone (PubChem CID 107721490) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is (7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(2,5-dihydroxyphenyl)methanone.
| Compound Name | (7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(2,5-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 107721490 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (7-amino-3,4-dihydro-1H-isoquinolin-2-yl)-(2,5-dihydroxyphenyl)methanone |
| SMILES | Nc1ccc2c(c1)CN(C(=O)c1cc(O)ccc1O)CC2 |
| InChI | InChI=1S/C16H16N2O3/c17-12-2-1-10-5-6-18(9-11(10)7-12)16(21)14-8-13(19)3-4-15(14)20/h1-4,7-8,19-20H,5-6,9,17H2 |
| InChIKey | OJRSOZONBLFHEQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|