C13H13N3O3 — CID 107721514
N-(5-amino-3-methyl-2-pyridinyl)-2,4-dihydroxybenzamide (PubChem CID 107721514) has the molecular formula C13H13N3O3 and a molecular weight of 259.27 g/mol. Its IUPAC name is N-(5-amino-3-methyl-2-pyridinyl)-2,4-dihydroxybenzamide.
| Compound Name | N-(5-amino-3-methyl-2-pyridinyl)-2,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 107721514 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(5-amino-3-methyl-2-pyridinyl)-2,4-dihydroxybenzamide |
| SMILES | Cc1cc(N)cnc1NC(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C13H13N3O3/c1-7-4-8(14)6-15-12(7)16-13(19)10-3-2-9(17)5-11(10)18/h2-6,17-18H,14H2,1H3,(H,15,16,19) |
| InChIKey | SZLOTKCDOIGVFL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |