C14H13F2N3O2 — CID 115910735
N-(5-amino-3-methyl-2-pyridinyl)-2-(difluoromethoxy)benzamide (PubChem CID 115910735) has the molecular formula C14H13F2N3O2 and a molecular weight of 293.27 g/mol. Its IUPAC name is N-(5-amino-3-methyl-2-pyridinyl)-2-(difluoromethoxy)benzamide.
| Compound Name | N-(5-amino-3-methyl-2-pyridinyl)-2-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 115910735 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-(5-amino-3-methyl-2-pyridinyl)-2-(difluoromethoxy)benzamide |
| SMILES | Cc1cc(N)cnc1NC(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C14H13F2N3O2/c1-8-6-9(17)7-18-12(8)19-13(20)10-4-2-3-5-11(10)21-14(15)16/h2-7,14H,17H2,1H3,(H,18,19,20) |
| InChIKey | POGFQQDPSUYOJQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |