C14H17N3O3 — CID 107722008
2-[4-(2,4-dihydroxybenzoyl)piperazin-1-yl]propanenitrile (PubChem CID 107722008) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[4-(2,4-dihydroxybenzoyl)piperazin-1-yl]propanenitrile.
| Compound Name | 2-[4-(2,4-dihydroxybenzoyl)piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 107722008 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[4-(2,4-dihydroxybenzoyl)piperazin-1-yl]propanenitrile |
| SMILES | CC(C#N)N1CCN(C(=O)c2ccc(O)cc2O)CC1 |
| InChI | InChI=1S/C14H17N3O3/c1-10(9-15)16-4-6-17(7-5-16)14(20)12-3-2-11(18)8-13(12)19/h2-3,8,10,18-19H,4-7H2,1H3 |
| InChIKey | HSXGKUSMALKBBR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |