C14H16ClN3O2 — CID 63337723
2-[4-(4-chloro-2-hydroxybenzoyl)piperazin-1-yl]propanenitrile (PubChem CID 63337723) has the molecular formula C14H16ClN3O2 and a molecular weight of 293.75 g/mol. Its IUPAC name is 2-[4-(4-chloro-2-hydroxybenzoyl)piperazin-1-yl]propanenitrile.
| Compound Name | 2-[4-(4-chloro-2-hydroxybenzoyl)piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 63337723 |
| Molecular Formula | C14H16ClN3O2 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-[4-(4-chloro-2-hydroxybenzoyl)piperazin-1-yl]propanenitrile |
| SMILES | CC(C#N)N1CCN(C(=O)c2ccc(Cl)cc2O)CC1 |
| InChI | InChI=1S/C14H16ClN3O2/c1-10(9-16)17-4-6-18(7-5-17)14(20)12-3-2-11(15)8-13(12)19/h2-3,8,10,19H,4-7H2,1H3 |
| InChIKey | NAMCMPHHNYXUOK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |