C14H17NO3 — CID 107723158
N-cyclopropyl-N-(cyclopropylmethyl)-2,5-dihydroxybenzamide (PubChem CID 107723158) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-cyclopropyl-N-(cyclopropylmethyl)-2,5-dihydroxybenzamide.
| Compound Name | N-cyclopropyl-N-(cyclopropylmethyl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107723158 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-cyclopropyl-N-(cyclopropylmethyl)-2,5-dihydroxybenzamide |
| SMILES | O=C(c1cc(O)ccc1O)N(CC1CC1)C1CC1 |
| InChI | InChI=1S/C14H17NO3/c16-11-5-6-13(17)12(7-11)14(18)15(10-3-4-10)8-9-1-2-9/h5-7,9-10,16-17H,1-4,8H2 |
| InChIKey | KMUFHKONXBMKON-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|