C16H22N2O3 — CID 107725344
N-cyclopropyl-2,5-dihydroxy-N-(piperidin-2-ylmethyl)benzamide (PubChem CID 107725344) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is N-cyclopropyl-2,5-dihydroxy-N-(piperidin-2-ylmethyl)benzamide.
| Compound Name | N-cyclopropyl-2,5-dihydroxy-N-(piperidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 107725344 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-cyclopropyl-2,5-dihydroxy-N-(piperidin-2-ylmethyl)benzamide |
| SMILES | O=C(c1cc(O)ccc1O)N(CC1CCCCN1)C1CC1 |
| InChI | InChI=1S/C16H22N2O3/c19-13-6-7-15(20)14(9-13)16(21)18(12-4-5-12)10-11-3-1-2-8-17-11/h6-7,9,11-12,17,19-20H,1-5,8,10H2 |
| InChIKey | TUEZEZASXPDJEO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|