C14H20N2O4 — CID 107725339
2,5-dihydroxy-N-(2-hydroxyethyl)-N-(pyrrolidin-2-ylmethyl)benzamide (PubChem CID 107725339) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2,5-dihydroxy-N-(2-hydroxyethyl)-N-(pyrrolidin-2-ylmethyl)benzamide.
| Compound Name | 2,5-dihydroxy-N-(2-hydroxyethyl)-N-(pyrrolidin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 107725339 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2,5-dihydroxy-N-(2-hydroxyethyl)-N-(pyrrolidin-2-ylmethyl)benzamide |
| SMILES | O=C(c1cc(O)ccc1O)N(CCO)CC1CCCN1 |
| InChI | InChI=1S/C14H20N2O4/c17-7-6-16(9-10-2-1-5-15-10)14(20)12-8-11(18)3-4-13(12)19/h3-4,8,10,15,17-19H,1-2,5-7,9H2 |
| InChIKey | FRGPYUUJHDGTJE-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|