C16H17BrO2 — CID 107723971
[4-[(4-bromo-3,5-dimethylphenoxy)methyl]phenyl]methanol (PubChem CID 107723971) has the molecular formula C16H17BrO2 and a molecular weight of 321.21 g/mol. Its IUPAC name is [4-[(4-bromo-3,5-dimethylphenoxy)methyl]phenyl]methanol.
| Compound Name | [4-[(4-bromo-3,5-dimethylphenoxy)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 107723971 |
| Molecular Formula | C16H17BrO2 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | [4-[(4-bromo-3,5-dimethylphenoxy)methyl]phenyl]methanol |
| SMILES | Cc1cc(OCc2ccc(CO)cc2)cc(C)c1Br |
| InChI | InChI=1S/C16H17BrO2/c1-11-7-15(8-12(2)16(11)17)19-10-14-5-3-13(9-18)4-6-14/h3-8,18H,9-10H2,1-2H3 |
| InChIKey | WGWFWGBZIXKRCA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |