C10H10N4O4 — CID 107724991
2,5-dihydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 107724991) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is 2,5-dihydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 2,5-dihydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 107724991 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2,5-dihydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | COc1n[nH]c(NC(=O)c2cc(O)ccc2O)n1 |
| InChI | InChI=1S/C10H10N4O4/c1-18-10-12-9(13-14-10)11-8(17)6-4-5(15)2-3-7(6)16/h2-4,15-16H,1H3,(H2,11,12,13,14,17) |
| InChIKey | AAKXXDFHTWESHN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|