C10H10N4O3 — CID 83086537
2-hydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 83086537) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 2-hydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 2-hydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 83086537 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-hydroxy-N-(3-methoxy-1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | COc1n[nH]c(NC(=O)c2ccccc2O)n1 |
| InChI | InChI=1S/C10H10N4O3/c1-17-10-12-9(13-14-10)11-8(16)6-4-2-3-5-7(6)15/h2-5,15H,1H3,(H2,11,12,13,14,16) |
| InChIKey | PMUNZOXXOXEWNO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |