C14H20N2O3 — CID 107725193
N-[2-(aminomethyl)cyclohexyl]-2,5-dihydroxybenzamide (PubChem CID 107725193) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2,5-dihydroxybenzamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107725193 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2,5-dihydroxybenzamide |
| SMILES | NCC1CCCCC1NC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H20N2O3/c15-8-9-3-1-2-4-12(9)16-14(19)11-7-10(17)5-6-13(11)18/h5-7,9,12,17-18H,1-4,8,15H2,(H,16,19) |
| InChIKey | PZVDBVSDNHACEK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|