C11H16N2O3 — CID 107726322
N-(2-aminopropyl)-2,5-dihydroxy-N-methylbenzamide (PubChem CID 107726322) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is N-(2-aminopropyl)-2,5-dihydroxy-N-methylbenzamide.
| Compound Name | N-(2-aminopropyl)-2,5-dihydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 107726322 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | N-(2-aminopropyl)-2,5-dihydroxy-N-methylbenzamide |
| SMILES | CC(N)CN(C)C(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C11H16N2O3/c1-7(12)6-13(2)11(16)9-5-8(14)3-4-10(9)15/h3-5,7,14-15H,6,12H2,1-2H3 |
| InChIKey | ADXYAVAEYLOGHL-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|