C12H17NO5 — CID 113347205
2,5-dihydroxy-N-(2-hydroxy-3-methoxypropyl)-N-methylbenzamide (PubChem CID 113347205) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2,5-dihydroxy-N-(2-hydroxy-3-methoxypropyl)-N-methylbenzamide.
| Compound Name | 2,5-dihydroxy-N-(2-hydroxy-3-methoxypropyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 113347205 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2,5-dihydroxy-N-(2-hydroxy-3-methoxypropyl)-N-methylbenzamide |
| SMILES | COCC(O)CN(C)C(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C12H17NO5/c1-13(6-9(15)7-18-2)12(17)10-5-8(14)3-4-11(10)16/h3-5,9,14-16H,6-7H2,1-2H3 |
| InChIKey | BACOXCKDGNDADS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|