C16H19BrN2O — CID 107726928
1-[5-(4-bromo-3,5-dimethylphenoxy)-3-pyridinyl]propan-2-amine (PubChem CID 107726928) has the molecular formula C16H19BrN2O and a molecular weight of 335.25 g/mol. Its IUPAC name is 1-[5-(4-bromo-3,5-dimethylphenoxy)-3-pyridinyl]propan-2-amine.
| Compound Name | 1-[5-(4-bromo-3,5-dimethylphenoxy)-3-pyridinyl]propan-2-amine |
|---|---|
| PubChem CID | 107726928 |
| Molecular Formula | C16H19BrN2O |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-[5-(4-bromo-3,5-dimethylphenoxy)-3-pyridinyl]propan-2-amine |
| SMILES | Cc1cc(Oc2cncc(CC(C)N)c2)cc(C)c1Br |
| InChI | InChI=1S/C16H19BrN2O/c1-10-4-14(5-11(2)16(10)17)20-15-7-13(6-12(3)18)8-19-9-15/h4-5,7-9,12H,6,18H2,1-3H3 |
| InChIKey | OKDNBXWQVQYDSB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |