About 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid
4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid (PubChem CID 107728145) has the molecular formula C14H17NO6
and a molecular weight of 295.29 g/mol. Its IUPAC name is 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid |
| PubChem CID | 107728145 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid |
| SMILES | CCN(C(=O)c1ccc(O)c(O)c1)C1COCC1C(=O)O |
| InChI | InChI=1S/C14H17NO6/c1-2-15(10-7-21-6-9(10)14(19)20)13(18)8-3-4-11(16)12(17)5-8/h3-5,9-10,16-17H,2,6-7H2,1H3,(H,19,20) |
| InChIKey | DYPAMJMEYDONSD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid?
The IUPAC name of 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid (CID 107728145) is 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid.
What is the SMILES notation for 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid?
The canonical SMILES for 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid is CCN(C(=O)c1ccc(O)c(O)c1)C1COCC1C(=O)O.
What is the InChIKey of 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid?
The InChIKey is DYPAMJMEYDONSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO6/c1-2-15(10-7-21-6-9(10)14(19)20)13(18)8-3-4-11(16)12(17)5-8/h3-5,9-10,16-17H,2,6-7H2,1H3,(H,19,20).
What are the key properties of 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid?
4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid has a molecular weight of 295.29 g/mol, XLogP of 0.66, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid is sourced from PubChem (CID 107728145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).