C14H17NO6 — CID 107728145
4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid (PubChem CID 107728145) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 107728145 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-[(3,4-dihydroxybenzoyl)-ethylamino]oxolane-3-carboxylic acid |
| SMILES | CCN(C(=O)c1ccc(O)c(O)c1)C1COCC1C(=O)O |
| InChI | InChI=1S/C14H17NO6/c1-2-15(10-7-21-6-9(10)14(19)20)13(18)8-3-4-11(16)12(17)5-8/h3-5,9-10,16-17H,2,6-7H2,1H3,(H,19,20) |
| InChIKey | DYPAMJMEYDONSD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|