4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid

C14H15Cl2NO4 — CID 66245241

IUPAC4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid
SMILESCCN(C(=O)c1ccc(Cl)cc1Cl)C1COCC1C(=O)O
InChIInChI=1S/C14H15Cl2NO4/c1-2-17(12-7-21-6-10(12)14(19)20)13(18)9-4-3-8(15)5-11(9)16/h3-5,10,12H,2,6-7H2,1H3,(H,19,20)
InChIKeyYWHSQYKWGBTSNU-UHFFFAOYSA-N
MW332.18 g/mol
LogP2.56
Rot. Bonds4

About 4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid

4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid (PubChem CID 66245241) has the molecular formula C14H15Cl2NO4 and a molecular weight of 332.18 g/mol. Its IUPAC name is 4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid.

Molecular Properties

Compound Name4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid
PubChem CID66245241
Molecular FormulaC14H15Cl2NO4
Molecular Weight332.18 g/mol
Exact Mass331.04
IUPAC Name4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid
SMILESCCN(C(=O)c1ccc(Cl)cc1Cl)C1COCC1C(=O)O
InChIInChI=1S/C14H15Cl2NO4/c1-2-17(12-7-21-6-10(12)14(19)20)13(18)9-4-3-8(15)5-11(9)16/h3-5,10,12H,2,6-7H2,1H3,(H,19,20)
InChIKeyYWHSQYKWGBTSNU-UHFFFAOYSA-N
XLogP2.56
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.18
LogP ≤ 52.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid?
The IUPAC name of 4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid (CID 66245241) is 4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid.
What is the SMILES notation for 4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid?
The canonical SMILES for 4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid is CCN(C(=O)c1ccc(Cl)cc1Cl)C1COCC1C(=O)O.
What is the InChIKey of 4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid?
The InChIKey is YWHSQYKWGBTSNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2NO4/c1-2-17(12-7-21-6-10(12)14(19)20)13(18)9-4-3-8(15)5-11(9)16/h3-5,10,12H,2,6-7H2,1H3,(H,19,20).
What are the key properties of 4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid?
4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid has a molecular weight of 332.18 g/mol, XLogP of 2.56, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dichlorobenzoyl)-ethylamino]oxolane-3-carboxylic acid is sourced from PubChem (CID 66245241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).