C15H19N3O3 — CID 107728338
2-[4-(3,4-dihydroxybenzoyl)piperazin-1-yl]-2-methylpropanenitrile (PubChem CID 107728338) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[4-(3,4-dihydroxybenzoyl)piperazin-1-yl]-2-methylpropanenitrile.
| Compound Name | 2-[4-(3,4-dihydroxybenzoyl)piperazin-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 107728338 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[4-(3,4-dihydroxybenzoyl)piperazin-1-yl]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)N1CCN(C(=O)c2ccc(O)c(O)c2)CC1 |
| InChI | InChI=1S/C15H19N3O3/c1-15(2,10-16)18-7-5-17(6-8-18)14(21)11-3-4-12(19)13(20)9-11/h3-4,9,19-20H,5-8H2,1-2H3 |
| InChIKey | GCFQQQUAJMMGKY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|