C13H19N5O — CID 60692955
2-methyl-2-[4-(1-methylpyrazole-4-carbonyl)piperazin-1-yl]propanenitrile (PubChem CID 60692955) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 2-methyl-2-[4-(1-methylpyrazole-4-carbonyl)piperazin-1-yl]propanenitrile.
| Compound Name | 2-methyl-2-[4-(1-methylpyrazole-4-carbonyl)piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 60692955 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 2-methyl-2-[4-(1-methylpyrazole-4-carbonyl)piperazin-1-yl]propanenitrile |
| SMILES | Cn1cc(C(=O)N2CCN(C(C)(C)C#N)CC2)cn1 |
| InChI | InChI=1S/C13H19N5O/c1-13(2,10-14)18-6-4-17(5-7-18)12(19)11-8-15-16(3)9-11/h8-9H,4-7H2,1-3H3 |
| InChIKey | WHGUBPGEVGGVJA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |