C13H11BrN2O5 — CID 107730942
4-[(2-bromo-5-nitroanilino)methyl]benzene-1,2,3-triol (PubChem CID 107730942) has the molecular formula C13H11BrN2O5 and a molecular weight of 355.14 g/mol. Its IUPAC name is 4-[(2-bromo-5-nitroanilino)methyl]benzene-1,2,3-triol.
| Compound Name | 4-[(2-bromo-5-nitroanilino)methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 107730942 |
| Molecular Formula | C13H11BrN2O5 |
| Molecular Weight | 355.14 g/mol |
| Exact Mass | 353.99 |
| IUPAC Name | 4-[(2-bromo-5-nitroanilino)methyl]benzene-1,2,3-triol |
| SMILES | O=[N+]([O-])c1ccc(Br)c(NCc2ccc(O)c(O)c2O)c1 |
| InChI | InChI=1S/C13H11BrN2O5/c14-9-3-2-8(16(20)21)5-10(9)15-6-7-1-4-11(17)13(19)12(7)18/h1-5,15,17-19H,6H2 |
| InChIKey | QYSQVEAEVCNDRB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 115.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.14 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|