C15H19ClINO2 — CID 107732635
N-[1-(chloromethyl)-3-methylcyclohexyl]-2-hydroxy-5-iodobenzamide (PubChem CID 107732635) has the molecular formula C15H19ClINO2 and a molecular weight of 407.68 g/mol. Its IUPAC name is N-[1-(chloromethyl)-3-methylcyclohexyl]-2-hydroxy-5-iodobenzamide.
| Compound Name | N-[1-(chloromethyl)-3-methylcyclohexyl]-2-hydroxy-5-iodobenzamide |
|---|---|
| PubChem CID | 107732635 |
| Molecular Formula | C15H19ClINO2 |
| Molecular Weight | 407.68 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | N-[1-(chloromethyl)-3-methylcyclohexyl]-2-hydroxy-5-iodobenzamide |
| SMILES | CC1CCCC(CCl)(NC(=O)c2cc(I)ccc2O)C1 |
| InChI | InChI=1S/C15H19ClINO2/c1-10-3-2-6-15(8-10,9-16)18-14(20)12-7-11(17)4-5-13(12)19/h4-5,7,10,19H,2-3,6,8-9H2,1H3,(H,18,20) |
| InChIKey | OHNJIMQYJUXMFC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.68 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|