C15H19ClINO — CID 113273147
N-[1-(chloromethyl)-3-methylcyclohexyl]-4-iodobenzamide (PubChem CID 113273147) has the molecular formula C15H19ClINO and a molecular weight of 391.68 g/mol. Its IUPAC name is N-[1-(chloromethyl)-3-methylcyclohexyl]-4-iodobenzamide.
| Compound Name | N-[1-(chloromethyl)-3-methylcyclohexyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 113273147 |
| Molecular Formula | C15H19ClINO |
| Molecular Weight | 391.68 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | N-[1-(chloromethyl)-3-methylcyclohexyl]-4-iodobenzamide |
| SMILES | CC1CCCC(CCl)(NC(=O)c2ccc(I)cc2)C1 |
| InChI | InChI=1S/C15H19ClINO/c1-11-3-2-8-15(9-11,10-16)18-14(19)12-4-6-13(17)7-5-12/h4-7,11H,2-3,8-10H2,1H3,(H,18,19) |
| InChIKey | ROELAZFTCZCMCF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|