C12H16N2O3 — CID 107734641
4-amino-N-(3-hydroxyphenyl)-N-methyloxolane-3-carboxamide (PubChem CID 107734641) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 4-amino-N-(3-hydroxyphenyl)-N-methyloxolane-3-carboxamide.
| Compound Name | 4-amino-N-(3-hydroxyphenyl)-N-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 107734641 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 4-amino-N-(3-hydroxyphenyl)-N-methyloxolane-3-carboxamide |
| SMILES | CN(C(=O)C1COCC1N)c1cccc(O)c1 |
| InChI | InChI=1S/C12H16N2O3/c1-14(8-3-2-4-9(15)5-8)12(16)10-6-17-7-11(10)13/h2-5,10-11,15H,6-7,13H2,1H3 |
| InChIKey | ZGJGBCUJPIWZTB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |