C13H19NO2 — CID 107735895
N-(3-hydroxyphenyl)-N,4-dimethylpentanamide (PubChem CID 107735895) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-N,4-dimethylpentanamide.
| Compound Name | N-(3-hydroxyphenyl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 107735895 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-(3-hydroxyphenyl)-N,4-dimethylpentanamide |
| SMILES | CC(C)CCC(=O)N(C)c1cccc(O)c1 |
| InChI | InChI=1S/C13H19NO2/c1-10(2)7-8-13(16)14(3)11-5-4-6-12(15)9-11/h4-6,9-10,15H,7-8H2,1-3H3 |
| InChIKey | MKXOJHOUOFXLAV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |