C15H13Cl2NO2 — CID 107736182
2,5-dichloro-N-ethyl-N-(3-hydroxyphenyl)benzamide (PubChem CID 107736182) has the molecular formula C15H13Cl2NO2 and a molecular weight of 310.18 g/mol. Its IUPAC name is 2,5-dichloro-N-ethyl-N-(3-hydroxyphenyl)benzamide.
| Compound Name | 2,5-dichloro-N-ethyl-N-(3-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 107736182 |
| Molecular Formula | C15H13Cl2NO2 |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 2,5-dichloro-N-ethyl-N-(3-hydroxyphenyl)benzamide |
| SMILES | CCN(C(=O)c1cc(Cl)ccc1Cl)c1cccc(O)c1 |
| InChI | InChI=1S/C15H13Cl2NO2/c1-2-18(11-4-3-5-12(19)9-11)15(20)13-8-10(16)6-7-14(13)17/h3-9,19H,2H2,1H3 |
| InChIKey | OPFPFSKEEBFIOK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |