C15H17BrN2O2 — CID 107737829
5-[(5-bromo-2-hydroxyphenyl)methylamino]-1-propylpyridin-2-one (PubChem CID 107737829) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is 5-[(5-bromo-2-hydroxyphenyl)methylamino]-1-propylpyridin-2-one.
| Compound Name | 5-[(5-bromo-2-hydroxyphenyl)methylamino]-1-propylpyridin-2-one |
|---|---|
| PubChem CID | 107737829 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 5-[(5-bromo-2-hydroxyphenyl)methylamino]-1-propylpyridin-2-one |
| SMILES | CCCn1cc(NCc2cc(Br)ccc2O)ccc1=O |
| InChI | InChI=1S/C15H17BrN2O2/c1-2-7-18-10-13(4-6-15(18)20)17-9-11-8-12(16)3-5-14(11)19/h3-6,8,10,17,19H,2,7,9H2,1H3 |
| InChIKey | CEHLHMHJYZQLKP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|