C14H16N2O3 — CID 54864095
5-[(2,4-dihydroxyphenyl)methylamino]-1-ethylpyridin-2-one (PubChem CID 54864095) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 5-[(2,4-dihydroxyphenyl)methylamino]-1-ethylpyridin-2-one.
| Compound Name | 5-[(2,4-dihydroxyphenyl)methylamino]-1-ethylpyridin-2-one |
|---|---|
| PubChem CID | 54864095 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5-[(2,4-dihydroxyphenyl)methylamino]-1-ethylpyridin-2-one |
| SMILES | CCn1cc(NCc2ccc(O)cc2O)ccc1=O |
| InChI | InChI=1S/C14H16N2O3/c1-2-16-9-11(4-6-14(16)19)15-8-10-3-5-12(17)7-13(10)18/h3-7,9,15,17-18H,2,8H2,1H3 |
| InChIKey | YTXCKHDBBYHZGP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|