C13H14Br2O4 — CID 107738643
3,5-dibromo-4-[(1-hydroxycyclopentyl)methoxy]benzoic acid (PubChem CID 107738643) has the molecular formula C13H14Br2O4 and a molecular weight of 394.06 g/mol. Its IUPAC name is 3,5-dibromo-4-[(1-hydroxycyclopentyl)methoxy]benzoic acid.
| Compound Name | 3,5-dibromo-4-[(1-hydroxycyclopentyl)methoxy]benzoic acid |
|---|---|
| PubChem CID | 107738643 |
| Molecular Formula | C13H14Br2O4 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 3,5-dibromo-4-[(1-hydroxycyclopentyl)methoxy]benzoic acid |
| SMILES | O=C(O)c1cc(Br)c(OCC2(O)CCCC2)c(Br)c1 |
| InChI | InChI=1S/C13H14Br2O4/c14-9-5-8(12(16)17)6-10(15)11(9)19-7-13(18)3-1-2-4-13/h5-6,18H,1-4,7H2,(H,16,17) |
| InChIKey | REJGSHDYTHWJES-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |