C12H12Br2N2O2 — CID 107739065
[3,5-dibromo-4-[(1-methylimidazol-2-yl)methoxy]phenyl]methanol (PubChem CID 107739065) has the molecular formula C12H12Br2N2O2 and a molecular weight of 376.05 g/mol. Its IUPAC name is [3,5-dibromo-4-[(1-methylimidazol-2-yl)methoxy]phenyl]methanol.
| Compound Name | [3,5-dibromo-4-[(1-methylimidazol-2-yl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 107739065 |
| Molecular Formula | C12H12Br2N2O2 |
| Molecular Weight | 376.05 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | [3,5-dibromo-4-[(1-methylimidazol-2-yl)methoxy]phenyl]methanol |
| SMILES | Cn1ccnc1COc1c(Br)cc(CO)cc1Br |
| InChI | InChI=1S/C12H12Br2N2O2/c1-16-3-2-15-11(16)7-18-12-9(13)4-8(6-17)5-10(12)14/h2-5,17H,6-7H2,1H3 |
| InChIKey | FYPGKFWRCRKGRE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.05 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |