C14H20Br2N2O3 — CID 107739572
2-[4-(2-aminoethyl)-2,6-dibromophenoxy]-N-(2-methoxyethyl)propanamide (PubChem CID 107739572) has the molecular formula C14H20Br2N2O3 and a molecular weight of 424.13 g/mol. Its IUPAC name is 2-[4-(2-aminoethyl)-2,6-dibromophenoxy]-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[4-(2-aminoethyl)-2,6-dibromophenoxy]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 107739572 |
| Molecular Formula | C14H20Br2N2O3 |
| Molecular Weight | 424.13 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 2-[4-(2-aminoethyl)-2,6-dibromophenoxy]-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)Oc1c(Br)cc(CCN)cc1Br |
| InChI | InChI=1S/C14H20Br2N2O3/c1-9(14(19)18-5-6-20-2)21-13-11(15)7-10(3-4-17)8-12(13)16/h7-9H,3-6,17H2,1-2H3,(H,18,19) |
| InChIKey | AUQASAGTLCUSLV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.13 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|