C10H10N2O2 — CID 10774027
1,3-dimethyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate (PubChem CID 10774027) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1,3-dimethyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate.
| Compound Name | 1,3-dimethyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate |
|---|---|
| PubChem CID | 10774027 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1,3-dimethyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-2-olate |
| SMILES | Cc1c([O-])[n+](C)c2ccccn2c1=O |
| InChI | InChI=1S/C10H10N2O2/c1-7-9(13)11(2)8-5-3-4-6-12(8)10(7)14/h3-6H,1-2H3 |
| InChIKey | DLRXKIWPJSJKOY-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|