About N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide
N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 3079272) has the molecular formula C11H11N3O2
and a molecular weight of 217.23 g/mol. Its IUPAC name is N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
Molecular Properties
| Compound Name | N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| PubChem CID | 3079272 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CNC(=O)c1cnc2cccc(C)n2c1=O |
| InChI | InChI=1S/C11H11N3O2/c1-7-4-3-5-9-13-6-8(10(15)12-2)11(16)14(7)9/h3-6H,1-2H3,(H,12,15) |
| InChIKey | YORPSDUDGJSDFZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide?
The IUPAC name of N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide (CID 3079272) is N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide.
What is the SMILES notation for N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide?
The canonical SMILES for N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide is CNC(=O)c1cnc2cccc(C)n2c1=O.
What is the InChIKey of N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide?
The InChIKey is YORPSDUDGJSDFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2/c1-7-4-3-5-9-13-6-8(10(15)12-2)11(16)14(7)9/h3-6H,1-2H3,(H,12,15).
What are the key properties of N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide?
N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide has a molecular weight of 217.23 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-dimethyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide is sourced from PubChem (CID 3079272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).