C15H19N3O2 — CID 3079277
6-methyl-4-oxo-N-pentylpyrido[1,2-a]pyrimidine-3-carboxamide (PubChem CID 3079277) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 6-methyl-4-oxo-N-pentylpyrido[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 6-methyl-4-oxo-N-pentylpyrido[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 3079277 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 6-methyl-4-oxo-N-pentylpyrido[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CCCCCNC(=O)c1cnc2cccc(C)n2c1=O |
| InChI | InChI=1S/C15H19N3O2/c1-3-4-5-9-16-14(19)12-10-17-13-8-6-7-11(2)18(13)15(12)20/h6-8,10H,3-5,9H2,1-2H3,(H,16,19) |
| InChIKey | SRGIKNPVXCAQFR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|