C15H21Br2NO — CID 107740899
2,6-dibromo-4-[[(2,2-dimethylcyclohexyl)amino]methyl]phenol (PubChem CID 107740899) has the molecular formula C15H21Br2NO and a molecular weight of 391.15 g/mol. Its IUPAC name is 2,6-dibromo-4-[[(2,2-dimethylcyclohexyl)amino]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[[(2,2-dimethylcyclohexyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 107740899 |
| Molecular Formula | C15H21Br2NO |
| Molecular Weight | 391.15 g/mol |
| Exact Mass | 389.00 |
| IUPAC Name | 2,6-dibromo-4-[[(2,2-dimethylcyclohexyl)amino]methyl]phenol |
| SMILES | CC1(C)CCCCC1NCc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C15H21Br2NO/c1-15(2)6-4-3-5-13(15)18-9-10-7-11(16)14(19)12(17)8-10/h7-8,13,18-19H,3-6,9H2,1-2H3 |
| InChIKey | OVLPRNPGZLBHIN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.15 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |