C17H25Br2NO — CID 107740537
2,6-dibromo-4-[[(2-tert-butylcyclohexyl)amino]methyl]phenol (PubChem CID 107740537) has the molecular formula C17H25Br2NO and a molecular weight of 419.20 g/mol. Its IUPAC name is 2,6-dibromo-4-[[(2-tert-butylcyclohexyl)amino]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[[(2-tert-butylcyclohexyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 107740537 |
| Molecular Formula | C17H25Br2NO |
| Molecular Weight | 419.20 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | 2,6-dibromo-4-[[(2-tert-butylcyclohexyl)amino]methyl]phenol |
| SMILES | CC(C)(C)C1CCCCC1NCc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C17H25Br2NO/c1-17(2,3)12-6-4-5-7-15(12)20-10-11-8-13(18)16(21)14(19)9-11/h8-9,12,15,20-21H,4-7,10H2,1-3H3 |
| InChIKey | DLKXJMXQORTRRJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.20 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |