C12H12N2O4 — CID 107743816
4-[4-(hydroxymethyl)-2-methoxyphenoxy]-1H-pyrimidin-6-one (PubChem CID 107743816) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-2-methoxyphenoxy]-1H-pyrimidin-6-one.
| Compound Name | 4-[4-(hydroxymethyl)-2-methoxyphenoxy]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 107743816 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-[4-(hydroxymethyl)-2-methoxyphenoxy]-1H-pyrimidin-6-one |
| SMILES | COc1cc(CO)ccc1Oc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C12H12N2O4/c1-17-10-4-8(6-15)2-3-9(10)18-12-5-11(16)13-7-14-12/h2-5,7,15H,6H2,1H3,(H,13,14,16) |
| InChIKey | FIGVTVGUOMSYPO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |